C21H19N3O4 — CID 53371971
2-[[1,3-dioxolan-2-ylmethyl(methyl)amino]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione (PubChem CID 53371971) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[[1,3-dioxolan-2-ylmethyl(methyl)amino]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
| Compound Name | 2-[[1,3-dioxolan-2-ylmethyl(methyl)amino]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
|---|---|
| PubChem CID | 53371971 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-[[1,3-dioxolan-2-ylmethyl(methyl)amino]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| SMILES | CN(Cc1nc2c3c(ccc2[nH]1)C(=O)c1ccccc1C3=O)CC1OCCO1 |
| InChI | InChI=1S/C21H19N3O4/c1-24(11-17-27-8-9-28-17)10-16-22-15-7-6-14-18(19(15)23-16)21(26)13-5-3-2-4-12(13)20(14)25/h2-7,17H,8-11H2,1H3,(H,22,23) |
| InChIKey | LDAIYJAQURWPPF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|