About 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine
2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine (PubChem CID 53372062) has the molecular formula C22H12F4N4
and a molecular weight of 408.36 g/mol. Its IUPAC name is 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine |
| PubChem CID | 53372062 |
| Molecular Formula | C22H12F4N4 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine |
| SMILES | Fc1ccc(C(F)(F)F)cc1-c1cc(-n2ccc3cnccc32)c2cccnc2n1 |
| InChI | InChI=1S/C22H12F4N4/c23-17-4-3-14(22(24,25)26)10-16(17)18-11-20(15-2-1-7-28-21(15)29-18)30-9-6-13-12-27-8-5-19(13)30/h1-12H |
| InChIKey | OJBRGVRUBNBXHV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine?
The IUPAC name of 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine (CID 53372062) is 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine.
What is the SMILES notation for 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine?
The canonical SMILES for 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine is Fc1ccc(C(F)(F)F)cc1-c1cc(-n2ccc3cnccc32)c2cccnc2n1.
What is the InChIKey of 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine?
The InChIKey is OJBRGVRUBNBXHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12F4N4/c23-17-4-3-14(22(24,25)26)10-16(17)18-11-20(15-2-1-7-28-21(15)29-18)30-9-6-13-12-27-8-5-19(13)30/h1-12H.
What are the key properties of 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine?
2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine has a molecular weight of 408.36 g/mol, XLogP of 5.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4-pyrrolo[3,2-c]pyridin-1-yl-1,8-naphthyridine is sourced from PubChem (CID 53372062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).