C22H24N6O2 — CID 53372082
N-methyl-3-[[4-(4-phenoxypiperidin-1-yl)-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 53372082) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-methyl-3-[[4-(4-phenoxypiperidin-1-yl)-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-methyl-3-[[4-(4-phenoxypiperidin-1-yl)-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 53372082 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-methyl-3-[[4-(4-phenoxypiperidin-1-yl)-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | CNC(=O)c1cccc(Nc2ncnc(N3CCC(Oc4ccccc4)CC3)n2)c1 |
| InChI | InChI=1S/C22H24N6O2/c1-23-20(29)16-6-5-7-17(14-16)26-21-24-15-25-22(27-21)28-12-10-19(11-13-28)30-18-8-3-2-4-9-18/h2-9,14-15,19H,10-13H2,1H3,(H,23,29)(H,24,25,26,27) |
| InChIKey | GWZPJOODPNBCRI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |