C24H23ClFN5O — CID 53372193
2-(5-chloro-2-fluorophenyl)-N-[3-[3-(dimethylamino)propoxy]-4-pyridinyl]-1,8-naphthyridin-4-amine (PubChem CID 53372193) has the molecular formula C24H23ClFN5O and a molecular weight of 451.93 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-N-[3-[3-(dimethylamino)propoxy]-4-pyridinyl]-1,8-naphthyridin-4-amine.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-N-[3-[3-(dimethylamino)propoxy]-4-pyridinyl]-1,8-naphthyridin-4-amine |
|---|---|
| PubChem CID | 53372193 |
| Molecular Formula | C24H23ClFN5O |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-N-[3-[3-(dimethylamino)propoxy]-4-pyridinyl]-1,8-naphthyridin-4-amine |
| SMILES | CN(C)CCCOc1cnccc1Nc1cc(-c2cc(Cl)ccc2F)nc2ncccc12 |
| InChI | InChI=1S/C24H23ClFN5O/c1-31(2)11-4-12-32-23-15-27-10-8-20(23)29-21-14-22(18-13-16(25)6-7-19(18)26)30-24-17(21)5-3-9-28-24/h3,5-10,13-15H,4,11-12H2,1-2H3,(H,27,28,29,30) |
| InChIKey | OKUDQASHHIYMFU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|