C23H21N3O4 — CID 53372232
2-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3H-naphtho[3,2-e]benzimidazole-6,11-dione (PubChem CID 53372232) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
| Compound Name | 2-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
|---|---|
| PubChem CID | 53372232 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1[nH]c(CN3CCC4(CC3)OCCO4)nc21 |
| InChI | InChI=1S/C23H21N3O4/c27-21-14-3-1-2-4-15(14)22(28)19-16(21)5-6-17-20(19)25-18(24-17)13-26-9-7-23(8-10-26)29-11-12-30-23/h1-6H,7-13H2,(H,24,25) |
| InChIKey | UTQOPORWSMXQLR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|