About 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione
2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione (PubChem CID 53372753) has the molecular formula C21H20N4O2
and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
Molecular Properties
| Compound Name | 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| PubChem CID | 53372753 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| SMILES | CN1CCN(Cc2nc3c4c(ccc3[nH]2)C(=O)c2ccccc2C4=O)CC1 |
| InChI | InChI=1S/C21H20N4O2/c1-24-8-10-25(11-9-24)12-17-22-16-7-6-15-18(19(16)23-17)21(27)14-5-3-2-4-13(14)20(15)26/h2-7H,8-12H2,1H3,(H,22,23) |
| InChIKey | FMYMGQTUHIDMGD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione?
The IUPAC name of 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione (CID 53372753) is 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
What is the SMILES notation for 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione?
The canonical SMILES for 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione is CN1CCN(Cc2nc3c4c(ccc3[nH]2)C(=O)c2ccccc2C4=O)CC1.
What is the InChIKey of 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione?
The InChIKey is FMYMGQTUHIDMGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O2/c1-24-8-10-25(11-9-24)12-17-22-16-7-6-15-18(19(16)23-17)21(27)14-5-3-2-4-13(14)20(15)26/h2-7H,8-12H2,1H3,(H,22,23).
What are the key properties of 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione?
2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione has a molecular weight of 360.42 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methylpiperazin-1-yl)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione is sourced from PubChem (CID 53372753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).