C21H24ClN3O — CID 53372887
1-(8-chloro-2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-6-yl)-2-pyridin-3-ylpropan-2-ol (PubChem CID 53372887) has the molecular formula C21H24ClN3O and a molecular weight of 369.90 g/mol. Its IUPAC name is 1-(8-chloro-2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-6-yl)-2-pyridin-3-ylpropan-2-ol.
| Compound Name | 1-(8-chloro-2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-6-yl)-2-pyridin-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 53372887 |
| Molecular Formula | C21H24ClN3O |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-(8-chloro-2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-6-yl)-2-pyridin-3-ylpropan-2-ol |
| SMILES | CN1CCc2c(c3cc(Cl)cc(CC(C)(O)c4cccnc4)c3n2C)C1 |
| InChI | InChI=1S/C21H24ClN3O/c1-21(26,15-5-4-7-23-12-15)11-14-9-16(22)10-17-18-13-24(2)8-6-19(18)25(3)20(14)17/h4-5,7,9-10,12,26H,6,8,11,13H2,1-3H3 |
| InChIKey | GTVJAWRERDGRJP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|