C24H27ClO2 — CID 53373009
2-chloro-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid (PubChem CID 53373009) has the molecular formula C24H27ClO2 and a molecular weight of 382.93 g/mol. Its IUPAC name is 2-chloro-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid.
| Compound Name | 2-chloro-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 53373009 |
| Molecular Formula | C24H27ClO2 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 2-chloro-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
| SMILES | C=C(c1ccc(C(=O)O)c(Cl)c1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H27ClO2/c1-14-11-19-20(24(5,6)10-9-23(19,3)4)13-18(14)15(2)16-7-8-17(22(26)27)21(25)12-16/h7-8,11-13H,2,9-10H2,1,3-6H3,(H,26,27) |
| InChIKey | OYSOCUROJIYZHJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |