C20H22ClN3O — CID 53373020
1-(8-chloro-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-6-yl)-2-pyridin-3-ylpropan-2-ol (PubChem CID 53373020) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is 1-(8-chloro-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-6-yl)-2-pyridin-3-ylpropan-2-ol.
| Compound Name | 1-(8-chloro-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-6-yl)-2-pyridin-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 53373020 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-(8-chloro-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-6-yl)-2-pyridin-3-ylpropan-2-ol |
| SMILES | Cn1c2c(c3cc(Cl)cc(CC(C)(O)c4cccnc4)c31)CNCC2 |
| InChI | InChI=1S/C20H22ClN3O/c1-20(25,14-4-3-6-22-11-14)10-13-8-15(21)9-16-17-12-23-7-5-18(17)24(2)19(13)16/h3-4,6,8-9,11,23,25H,5,7,10,12H2,1-2H3 |
| InChIKey | FLYXMYDOFKVILW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|