C23H26ClN3O — CID 53373156
1-(10-chloro-7-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-ol (PubChem CID 53373156) has the molecular formula C23H26ClN3O and a molecular weight of 395.93 g/mol. Its IUPAC name is 1-(10-chloro-7-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-ol.
| Compound Name | 1-(10-chloro-7-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 53373156 |
| Molecular Formula | C23H26ClN3O |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-(10-chloro-7-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-ol |
| SMILES | Cn1c2c(c3cc(Cl)cc(CC(C)(O)c4cccnc4)c31)C1CCCN1CC2 |
| InChI | InChI=1S/C23H26ClN3O/c1-23(28,16-5-3-8-25-14-16)13-15-11-17(24)12-18-21-19(26(2)22(15)18)7-10-27-9-4-6-20(21)27/h3,5,8,11-12,14,20,28H,4,6-7,9-10,13H2,1-2H3 |
| InChIKey | HVRLYCUHQXSRJR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|