C21H17F2N3O2 — CID 53373252
1-[(2-amino-3,5-difluorophenyl)methyl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinolin-4-one (PubChem CID 53373252) has the molecular formula C21H17F2N3O2 and a molecular weight of 381.38 g/mol. Its IUPAC name is 1-[(2-amino-3,5-difluorophenyl)methyl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinolin-4-one.
| Compound Name | 1-[(2-amino-3,5-difluorophenyl)methyl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinolin-4-one |
|---|---|
| PubChem CID | 53373252 |
| Molecular Formula | C21H17F2N3O2 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-[(2-amino-3,5-difluorophenyl)methyl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinolin-4-one |
| SMILES | Cc1noc(C)c1-c1ccc2c(=O)ccn(Cc3cc(F)cc(F)c3N)c2c1 |
| InChI | InChI=1S/C21H17F2N3O2/c1-11-20(12(2)28-25-11)13-3-4-16-18(8-13)26(6-5-19(16)27)10-14-7-15(22)9-17(23)21(14)24/h3-9H,10,24H2,1-2H3 |
| InChIKey | FENNZEXEINJNOU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|