C29H38N4O2 — CID 53373290
[1-(7,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-yl] 2-amino-3-methylbutanoate (PubChem CID 53373290) has the molecular formula C29H38N4O2 and a molecular weight of 474.65 g/mol. Its IUPAC name is [1-(7,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-yl] 2-amino-3-methylbutanoate.
| Compound Name | [1-(7,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-yl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 53373290 |
| Molecular Formula | C29H38N4O2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | [1-(7,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-yl] 2-amino-3-methylbutanoate |
| SMILES | Cc1cc(CC(C)(OC(=O)C(N)C(C)C)c2cccnc2)c2c(c1)c1c(n2C)CCN2CCCC12 |
| InChI | InChI=1S/C29H38N4O2/c1-18(2)26(30)28(34)35-29(4,21-8-6-11-31-17-21)16-20-14-19(3)15-22-25-23(32(5)27(20)22)10-13-33-12-7-9-24(25)33/h6,8,11,14-15,17-18,24,26H,7,9-10,12-13,16,30H2,1-5H3 |
| InChIKey | VVWOERQYAOXGTE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|