C24H20O2 — CID 53373394
3-[(E)-2-phenylethenyl]-6-prop-1-en-2-yl-9H-xanthen-1-ol (PubChem CID 53373394) has the molecular formula C24H20O2 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-[(E)-2-phenylethenyl]-6-prop-1-en-2-yl-9H-xanthen-1-ol.
| Compound Name | 3-[(E)-2-phenylethenyl]-6-prop-1-en-2-yl-9H-xanthen-1-ol |
|---|---|
| PubChem CID | 53373394 |
| Molecular Formula | C24H20O2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-[(E)-2-phenylethenyl]-6-prop-1-en-2-yl-9H-xanthen-1-ol |
| SMILES | C=C(C)c1ccc2c(c1)Oc1cc(/C=C/c3ccccc3)cc(O)c1C2 |
| InChI | InChI=1S/C24H20O2/c1-16(2)19-10-11-20-14-21-22(25)12-18(13-24(21)26-23(20)15-19)9-8-17-6-4-3-5-7-17/h3-13,15,25H,1,14H2,2H3/b9-8+ |
| InChIKey | LJFVMXMQASRDIP-CMDGGOBGSA-N |
| XLogP | 6.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|