C27H34N4O2 — CID 53373425
[1-(7,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-yl] 2-aminopropanoate (PubChem CID 53373425) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is [1-(7,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-yl] 2-aminopropanoate.
| Compound Name | [1-(7,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-yl] 2-aminopropanoate |
|---|---|
| PubChem CID | 53373425 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | [1-(7,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-8-yl)-2-pyridin-3-ylpropan-2-yl] 2-aminopropanoate |
| SMILES | Cc1cc(CC(C)(OC(=O)C(C)N)c2cccnc2)c2c(c1)c1c(n2C)CCN2CCCC12 |
| InChI | InChI=1S/C27H34N4O2/c1-17-13-19(15-27(3,33-26(32)18(2)28)20-7-5-10-29-16-20)25-21(14-17)24-22(30(25)4)9-12-31-11-6-8-23(24)31/h5,7,10,13-14,16,18,23H,6,8-9,11-12,15,28H2,1-4H3 |
| InChIKey | ZKWKDYBGJYKWJY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|