C14H8F5N3O2 — CID 53373686
N-[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]-[1,2]oxazolo[4,5-b]pyridin-3-amine (PubChem CID 53373686) has the molecular formula C14H8F5N3O2 and a molecular weight of 345.23 g/mol. Its IUPAC name is N-[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]-[1,2]oxazolo[4,5-b]pyridin-3-amine.
| Compound Name | N-[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]-[1,2]oxazolo[4,5-b]pyridin-3-amine |
|---|---|
| PubChem CID | 53373686 |
| Molecular Formula | C14H8F5N3O2 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | N-[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]-[1,2]oxazolo[4,5-b]pyridin-3-amine |
| SMILES | FC(F)(F)C(F)(F)Oc1cccc(Nc2noc3cccnc23)c1 |
| InChI | InChI=1S/C14H8F5N3O2/c15-13(16,17)14(18,19)23-9-4-1-3-8(7-9)21-12-11-10(24-22-12)5-2-6-20-11/h1-7H,(H,21,22) |
| InChIKey | IKKYOQQIRVUYEN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|