About N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine
N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine (PubChem CID 53373899) has the molecular formula C16H10ClN5O2
and a molecular weight of 339.74 g/mol. Its IUPAC name is N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine.
Molecular Properties
| Compound Name | N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine |
| PubChem CID | 53373899 |
| Molecular Formula | C16H10ClN5O2 |
| Molecular Weight | 339.74 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine |
| SMILES | Clc1cc(Nc2noc3cccnc23)ccc1Oc1cnccn1 |
| InChI | InChI=1S/C16H10ClN5O2/c17-11-8-10(3-4-12(11)23-14-9-18-6-7-19-14)21-16-15-13(24-22-16)2-1-5-20-15/h1-9H,(H,21,22) |
| InChIKey | IAYIPTNAGWTOCT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.74 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine?
The IUPAC name of N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine (CID 53373899) is N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine.
What is the SMILES notation for N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine?
The canonical SMILES for N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine is Clc1cc(Nc2noc3cccnc23)ccc1Oc1cnccn1.
What is the InChIKey of N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine?
The InChIKey is IAYIPTNAGWTOCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN5O2/c17-11-8-10(3-4-12(11)23-14-9-18-6-7-19-14)21-16-15-13(24-22-16)2-1-5-20-15/h1-9H,(H,21,22).
What are the key properties of N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine?
N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine has a molecular weight of 339.74 g/mol, XLogP of 4.20, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-4-pyrazin-2-yloxyphenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine is sourced from PubChem (CID 53373899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).