About N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine
N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine (PubChem CID 53374001) has the molecular formula C13H10ClFN4
and a molecular weight of 276.70 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine |
| PubChem CID | 53374001 |
| Molecular Formula | C13H10ClFN4 |
| Molecular Weight | 276.70 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine |
| SMILES | Fc1ccc(CNc2n[nH]c3cccnc23)cc1Cl |
| InChI | InChI=1S/C13H10ClFN4/c14-9-6-8(3-4-10(9)15)7-17-13-12-11(18-19-13)2-1-5-16-12/h1-6H,7H2,(H2,17,18,19) |
| InChIKey | RBRTYAMQYDHHJU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine?
The IUPAC name of N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine (CID 53374001) is N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine.
What is the SMILES notation for N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine?
The canonical SMILES for N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine is Fc1ccc(CNc2n[nH]c3cccnc23)cc1Cl.
What is the InChIKey of N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine?
The InChIKey is RBRTYAMQYDHHJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClFN4/c14-9-6-8(3-4-10(9)15)7-17-13-12-11(18-19-13)2-1-5-16-12/h1-6H,7H2,(H2,17,18,19).
What are the key properties of N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine?
N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine has a molecular weight of 276.70 g/mol, XLogP of 3.36, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-chloro-4-fluorophenyl)methyl]-1H-pyrazolo[4,3-b]pyridin-3-amine is sourced from PubChem (CID 53374001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).