About 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate
2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate (PubChem CID 53374166) has the molecular formula C27H36O5
and a molecular weight of 440.58 g/mol. Its IUPAC name is 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate |
| PubChem CID | 53374166 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate |
| SMILES | COc1cccc(/C=C/c2ccc(OC)c(OCCCC(C)(C)C(=O)OCC(C)C)c2)c1 |
| InChI | InChI=1S/C27H36O5/c1-20(2)19-32-26(28)27(3,4)15-8-16-31-25-18-22(13-14-24(25)30-6)12-11-21-9-7-10-23(17-21)29-5/h7,9-14,17-18,20H,8,15-16,19H2,1-6H3/b12-11+ |
| InChIKey | SGTUZPLMANFFJX-VAWYXSNFSA-N |
| XLogP | 6.26 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate?
The IUPAC name of 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate (CID 53374166) is 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate.
What is the SMILES notation for 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate?
The canonical SMILES for 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate is COc1cccc(/C=C/c2ccc(OC)c(OCCCC(C)(C)C(=O)OCC(C)C)c2)c1.
What is the InChIKey of 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate?
The InChIKey is SGTUZPLMANFFJX-VAWYXSNFSA-N. The full InChI is InChI=1S/C27H36O5/c1-20(2)19-32-26(28)27(3,4)15-8-16-31-25-18-22(13-14-24(25)30-6)12-11-21-9-7-10-23(17-21)29-5/h7,9-14,17-18,20H,8,15-16,19H2,1-6H3/b12-11+.
What are the key properties of 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate?
2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate has a molecular weight of 440.58 g/mol, XLogP of 6.26, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 5-[2-methoxy-5-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-2,2-dimethylpentanoate is sourced from PubChem (CID 53374166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).