About 1,1,2,2-tetraethoxyethene
1,1,2,2-tetraethoxyethene (PubChem CID 533743) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is 1,1,2,2-tetraethoxyethene.
Molecular Properties
| Compound Name | 1,1,2,2-tetraethoxyethene |
| PubChem CID | 533743 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 1,1,2,2-tetraethoxyethene |
| SMILES | CCOC(OCC)=C(OCC)OCC |
| InChI | InChI=1S/C10H20O4/c1-5-11-9(12-6-2)10(13-7-3)14-8-4/h5-8H2,1-4H3 |
| InChIKey | WQNVSQDMXNPYNW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2,2-tetraethoxyethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2,2-tetraethoxyethene?
The IUPAC name of 1,1,2,2-tetraethoxyethene (CID 533743) is 1,1,2,2-tetraethoxyethene.
What is the SMILES notation for 1,1,2,2-tetraethoxyethene?
The canonical SMILES for 1,1,2,2-tetraethoxyethene is CCOC(OCC)=C(OCC)OCC.
What is the InChIKey of 1,1,2,2-tetraethoxyethene?
The InChIKey is WQNVSQDMXNPYNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-5-11-9(12-6-2)10(13-7-3)14-8-4/h5-8H2,1-4H3.
What are the key properties of 1,1,2,2-tetraethoxyethene?
1,1,2,2-tetraethoxyethene has a molecular weight of 204.27 g/mol, XLogP of 2.26, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,2-tetraethoxyethene is sourced from PubChem (CID 533743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).