C26H38N6O6S — CID 53374300
(1R,2S,3R,5S)-3-[[2-(2-ethoxyethylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxy-1,3-dimethoxypropan-2-yl)cyclopentane-1,2-diol (PubChem CID 53374300) has the molecular formula C26H38N6O6S and a molecular weight of 562.69 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[[2-(2-ethoxyethylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxy-1,3-dimethoxypropan-2-yl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-[[2-(2-ethoxyethylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxy-1,3-dimethoxypropan-2-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 53374300 |
| Molecular Formula | C26H38N6O6S |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | (1R,2S,3R,5S)-3-[[2-(2-ethoxyethylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxy-1,3-dimethoxypropan-2-yl)cyclopentane-1,2-diol |
| SMILES | CCOCCNc1nc(C)c(-c2nc3c(C)nccc3s2)c(N[C@@H]2C[C@H](C(O)(COC)COC)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C26H38N6O6S/c1-6-38-10-9-28-25-29-14(2)19(24-31-20-15(3)27-8-7-18(20)39-24)23(32-25)30-17-11-16(21(33)22(17)34)26(35,12-36-4)13-37-5/h7-8,16-17,21-22,33-35H,6,9-13H2,1-5H3,(H2,28,29,30,32)/t16-,17+,21+,22-/m0/s1 |
| InChIKey | XONZVJBHKHBKGQ-DVRVPYBTSA-N |
| XLogP | 1.76 |
| TPSA | 164.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|