C20H26N6O3S — CID 53374301
(1R,2S,3R,5S)-3-[[2-amino-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol (PubChem CID 53374301) has the molecular formula C20H26N6O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[[2-amino-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-[[2-amino-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 53374301 |
| Molecular Formula | C20H26N6O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (1R,2S,3R,5S)-3-[[2-amino-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(N)nc(N[C@@H]2C[C@H](C(C)(C)O)[C@@H](O)[C@H]2O)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C20H26N6O3S/c1-8-13(18-25-14-9(2)22-6-5-12(14)30-18)17(26-19(21)23-8)24-11-7-10(20(3,4)29)15(27)16(11)28/h5-6,10-11,15-16,27-29H,7H2,1-4H3,(H3,21,23,24,26)/t10-,11+,15+,16-/m0/s1 |
| InChIKey | XKGDFSBJHUQVIH-TZCMFKBTSA-N |
| XLogP | 1.64 |
| TPSA | 150.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |