C23H32N6O4S — CID 53374399
(1S,2R,3S,5R)-3-(2-hydroxypropan-2-yl)-5-[[2-(2-methoxyethylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 53374399) has the molecular formula C23H32N6O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-(2-hydroxypropan-2-yl)-5-[[2-(2-methoxyethylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-(2-hydroxypropan-2-yl)-5-[[2-(2-methoxyethylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 53374399 |
| Molecular Formula | C23H32N6O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | (1S,2R,3S,5R)-3-(2-hydroxypropan-2-yl)-5-[[2-(2-methoxyethylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | COCCNc1nc(C)c(-c2nc3c(C)nccc3s2)c(N[C@@H]2C[C@H](C(C)(C)O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C23H32N6O4S/c1-11-16(21-28-17-12(2)24-7-6-15(17)34-21)20(29-22(26-11)25-8-9-33-5)27-14-10-13(23(3,4)32)18(30)19(14)31/h6-7,13-14,18-19,30-32H,8-10H2,1-5H3,(H2,25,26,27,29)/t13-,14+,18+,19-/m0/s1 |
| InChIKey | DTVAIVFZXBLGOR-RAKLQZGLSA-N |
| XLogP | 2.12 |
| TPSA | 145.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|