C19H15ClN4O — CID 53374407
N-(3-chloro-4-phenylmethoxyphenyl)-1H-pyrazolo[4,3-b]pyridin-3-amine (PubChem CID 53374407) has the molecular formula C19H15ClN4O and a molecular weight of 350.81 g/mol. Its IUPAC name is N-(3-chloro-4-phenylmethoxyphenyl)-1H-pyrazolo[4,3-b]pyridin-3-amine.
| Compound Name | N-(3-chloro-4-phenylmethoxyphenyl)-1H-pyrazolo[4,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 53374407 |
| Molecular Formula | C19H15ClN4O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-(3-chloro-4-phenylmethoxyphenyl)-1H-pyrazolo[4,3-b]pyridin-3-amine |
| SMILES | Clc1cc(Nc2n[nH]c3cccnc23)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C19H15ClN4O/c20-15-11-14(22-19-18-16(23-24-19)7-4-10-21-18)8-9-17(15)25-12-13-5-2-1-3-6-13/h1-11H,12H2,(H2,22,23,24) |
| InChIKey | RVEIPERWACOAFV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |