About 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid
2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid (PubChem CID 53374543) has the molecular formula C12H19O9PS
and a molecular weight of 370.32 g/mol. Its IUPAC name is 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid.
Molecular Properties
| Compound Name | 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid |
| PubChem CID | 53374543 |
| Molecular Formula | C12H19O9PS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(CP(O)(=S)CC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H19O9PS/c13-9(14)3-1-7(11(17)18)5-22(21,23)6-8(12(19)20)2-4-10(15)16/h7-8H,1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)(H,21,23) |
| InChIKey | FYGWHKYVGDTNMU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid?
The IUPAC name of 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid (CID 53374543) is 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid.
What is the SMILES notation for 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid?
The canonical SMILES for 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid is O=C(O)CCC(CP(O)(=S)CC(CCC(=O)O)C(=O)O)C(=O)O.
What is the InChIKey of 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid?
The InChIKey is FYGWHKYVGDTNMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19O9PS/c13-9(14)3-1-7(11(17)18)5-22(21,23)6-8(12(19)20)2-4-10(15)16/h7-8H,1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)(H,21,23).
What are the key properties of 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid?
2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid has a molecular weight of 370.32 g/mol, XLogP of 0.50, 12 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,4-dicarboxybutyl(hydroxy)phosphinothioyl]methyl]pentanedioic acid is sourced from PubChem (CID 53374543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).