About N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine
N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine (PubChem CID 53375008) has the molecular formula C12H8FN3O
and a molecular weight of 229.21 g/mol. Its IUPAC name is N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine.
Molecular Properties
| Compound Name | N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine |
| PubChem CID | 53375008 |
| Molecular Formula | C12H8FN3O |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine |
| SMILES | Fc1cccc(Nc2noc3cccnc23)c1 |
| InChI | InChI=1S/C12H8FN3O/c13-8-3-1-4-9(7-8)15-12-11-10(17-16-12)5-2-6-14-11/h1-7H,(H,15,16) |
| InChIKey | AUDNYCYOYQBLEH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine?
The IUPAC name of N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine (CID 53375008) is N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine.
What is the SMILES notation for N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine?
The canonical SMILES for N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine is Fc1cccc(Nc2noc3cccnc23)c1.
What is the InChIKey of N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine?
The InChIKey is AUDNYCYOYQBLEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8FN3O/c13-8-3-1-4-9(7-8)15-12-11-10(17-16-12)5-2-6-14-11/h1-7H,(H,15,16).
What are the key properties of N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine?
N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine has a molecular weight of 229.21 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine is sourced from PubChem (CID 53375008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).