C13H9F15O2 — CID 53375092
propan-2-yl 2-(difluoromethylidene)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate (PubChem CID 53375092) has the molecular formula C13H9F15O2 and a molecular weight of 482.18 g/mol. Its IUPAC name is propan-2-yl 2-(difluoromethylidene)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate.
| Compound Name | propan-2-yl 2-(difluoromethylidene)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate |
|---|---|
| PubChem CID | 53375092 |
| Molecular Formula | C13H9F15O2 |
| Molecular Weight | 482.18 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | propan-2-yl 2-(difluoromethylidene)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate |
| SMILES | CC(C)OC(=O)C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=C(F)F |
| InChI | InChI=1S/C13H9F15O2/c1-4(2)30-7(29)5(6(14)15)3-8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)28/h4H,3H2,1-2H3 |
| InChIKey | KUCUFZYKKJDWRT-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.18 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|