2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid

C6H3F7O2 — CID 53375094

IUPAC2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid
SMILESO=C(O)C(CC(F)(F)C(F)(F)F)=C(F)F
InChIInChI=1S/C6H3F7O2/c7-3(8)2(4(14)15)1-5(9,10)6(11,12)13/h1H2,(H,14,15)
InChIKeyUENYCJXJJRUIIY-UHFFFAOYSA-N
MW240.07 g/mol
LogP2.81
Rot. Bonds3

About 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid

2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid (PubChem CID 53375094) has the molecular formula C6H3F7O2 and a molecular weight of 240.07 g/mol. Its IUPAC name is 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid.

Molecular Properties

Compound Name2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid
PubChem CID53375094
Molecular FormulaC6H3F7O2
Molecular Weight240.07 g/mol
Exact Mass240.00
IUPAC Name2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid
SMILESO=C(O)C(CC(F)(F)C(F)(F)F)=C(F)F
InChIInChI=1S/C6H3F7O2/c7-3(8)2(4(14)15)1-5(9,10)6(11,12)13/h1H2,(H,14,15)
InChIKeyUENYCJXJJRUIIY-UHFFFAOYSA-N
XLogP2.81
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.07
LogP ≤ 52.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid?
The IUPAC name of 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid (CID 53375094) is 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid.
What is the SMILES notation for 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid?
The canonical SMILES for 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid is O=C(O)C(CC(F)(F)C(F)(F)F)=C(F)F.
What is the InChIKey of 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid?
The InChIKey is UENYCJXJJRUIIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F7O2/c7-3(8)2(4(14)15)1-5(9,10)6(11,12)13/h1H2,(H,14,15).
What are the key properties of 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid?
2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid has a molecular weight of 240.07 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid is sourced from PubChem (CID 53375094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).