C6H3F7O2 — CID 53375094
2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid (PubChem CID 53375094) has the molecular formula C6H3F7O2 and a molecular weight of 240.07 g/mol. Its IUPAC name is 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid.
| Compound Name | 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid |
|---|---|
| PubChem CID | 53375094 |
| Molecular Formula | C6H3F7O2 |
| Molecular Weight | 240.07 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | 2-(difluoromethylidene)-4,4,5,5,5-pentafluoropentanoic acid |
| SMILES | O=C(O)C(CC(F)(F)C(F)(F)F)=C(F)F |
| InChI | InChI=1S/C6H3F7O2/c7-3(8)2(4(14)15)1-5(9,10)6(11,12)13/h1H2,(H,14,15) |
| InChIKey | UENYCJXJJRUIIY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.07 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|