C21H35NO4Si — CID 53375271
(3aR,5S,6R,6aR)-N-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-amine (PubChem CID 53375271) has the molecular formula C21H35NO4Si and a molecular weight of 393.60 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-N-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-amine.
| Compound Name | (3aR,5S,6R,6aR)-N-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-amine |
|---|---|
| PubChem CID | 53375271 |
| Molecular Formula | C21H35NO4Si |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (3aR,5S,6R,6aR)-N-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-amine |
| SMILES | CC1(C)O[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](NCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C21H35NO4Si/c1-20(2,3)27(6,7)23-14-16-17(22-13-15-11-9-8-10-12-15)18-19(24-16)26-21(4,5)25-18/h8-12,16-19,22H,13-14H2,1-7H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | SJPSYYJOSUWKOV-NCXUSEDFSA-N |
| XLogP | 4.04 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|