C18H21NO3 — CID 53375278
(1S,5R,8S)-10-benzyl-8-methyl-3-oxa-10-azatricyclo[6.3.1.01,5]dodecane-2,12-dione (PubChem CID 53375278) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (1S,5R,8S)-10-benzyl-8-methyl-3-oxa-10-azatricyclo[6.3.1.01,5]dodecane-2,12-dione.
| Compound Name | (1S,5R,8S)-10-benzyl-8-methyl-3-oxa-10-azatricyclo[6.3.1.01,5]dodecane-2,12-dione |
|---|---|
| PubChem CID | 53375278 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (1S,5R,8S)-10-benzyl-8-methyl-3-oxa-10-azatricyclo[6.3.1.01,5]dodecane-2,12-dione |
| SMILES | C[C@]12CC[C@H]3COC(=O)[C@@]3(CN(Cc3ccccc3)C1)C2=O |
| InChI | InChI=1S/C18H21NO3/c1-17-8-7-14-10-22-16(21)18(14,15(17)20)12-19(11-17)9-13-5-3-2-4-6-13/h2-6,14H,7-12H2,1H3/t14-,17-,18+/m0/s1 |
| InChIKey | RPTVHWNIRCPZLC-JCGIZDLHSA-N |
| XLogP | 2.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|