C24H42O2Si — CID 53375282
(4bS,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4b,8,8-trimethyl-1,2,3,4,5,6,7,8a,9,10-decahydrophenanthrene-2-carbaldehyde (PubChem CID 53375282) has the molecular formula C24H42O2Si and a molecular weight of 390.68 g/mol. Its IUPAC name is (4bS,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4b,8,8-trimethyl-1,2,3,4,5,6,7,8a,9,10-decahydrophenanthrene-2-carbaldehyde.
| Compound Name | (4bS,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4b,8,8-trimethyl-1,2,3,4,5,6,7,8a,9,10-decahydrophenanthrene-2-carbaldehyde |
|---|---|
| PubChem CID | 53375282 |
| Molecular Formula | C24H42O2Si |
| Molecular Weight | 390.68 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | (4bS,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4b,8,8-trimethyl-1,2,3,4,5,6,7,8a,9,10-decahydrophenanthrene-2-carbaldehyde |
| SMILES | CC1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)C3=C(CC[C@@H]12)CC(C=O)CC3 |
| InChI | InChI=1S/C24H42O2Si/c1-22(2,3)27(7,8)26-21-13-14-24(6)19-11-9-17(16-25)15-18(19)10-12-20(24)23(21,4)5/h16-17,20-21H,9-15H2,1-8H3/t17?,20-,21-,24+/m0/s1 |
| InChIKey | WZARIVRHHADTEE-QPZUDQNTSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.68 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|