About (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine
(E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine (PubChem CID 5337535) has the molecular formula C11H10N4
and a molecular weight of 198.23 g/mol. Its IUPAC name is (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine.
Molecular Properties
| Compound Name | (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine |
| PubChem CID | 5337535 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine |
| SMILES | C(=C/c1ccccc1)\C=N\n1cnnc1 |
| InChI | InChI=1S/C11H10N4/c1-2-5-11(6-3-1)7-4-8-14-15-9-12-13-10-15/h1-10H/b7-4+,14-8+ |
| InChIKey | HIQAKCUTUJDMGW-CUJDEGIUSA-N |
| XLogP | 1.83 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine?
The IUPAC name of (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine (CID 5337535) is (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine.
What is the SMILES notation for (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine?
The canonical SMILES for (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine is C(=C/c1ccccc1)\C=N\n1cnnc1.
What is the InChIKey of (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine?
The InChIKey is HIQAKCUTUJDMGW-CUJDEGIUSA-N. The full InChI is InChI=1S/C11H10N4/c1-2-5-11(6-3-1)7-4-8-14-15-9-12-13-10-15/h1-10H/b7-4+,14-8+.
What are the key properties of (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine?
(E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine has a molecular weight of 198.23 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E,E)-3-phenyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine is sourced from PubChem (CID 5337535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).