C20H18ClNO4 — CID 53375447
methyl (2R,3S,4aS)-3-(4-chlorophenyl)-8-methyl-1-oxo-2,3,4,4a-tetrahydropyrido[2,1-b][1,3]benzoxazole-2-carboxylate (PubChem CID 53375447) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is methyl (2R,3S,4aS)-3-(4-chlorophenyl)-8-methyl-1-oxo-2,3,4,4a-tetrahydropyrido[2,1-b][1,3]benzoxazole-2-carboxylate.
| Compound Name | methyl (2R,3S,4aS)-3-(4-chlorophenyl)-8-methyl-1-oxo-2,3,4,4a-tetrahydropyrido[2,1-b][1,3]benzoxazole-2-carboxylate |
|---|---|
| PubChem CID | 53375447 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | methyl (2R,3S,4aS)-3-(4-chlorophenyl)-8-methyl-1-oxo-2,3,4,4a-tetrahydropyrido[2,1-b][1,3]benzoxazole-2-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)N2c3cc(C)ccc3O[C@H]2C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO4/c1-11-3-8-16-15(9-11)22-17(26-16)10-14(12-4-6-13(21)7-5-12)18(19(22)23)20(24)25-2/h3-9,14,17-18H,10H2,1-2H3/t14-,17+,18-/m1/s1 |
| InChIKey | SDIIOZJQPBBMDD-FHLIZLRMSA-N |
| XLogP | 3.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|