C24H28N2O5 — CID 53376018
(3aR,6S,6aS,9aS,9bR)-3'-[4-(dimethylamino)phenyl]-6a-hydroxy-6,9a-dimethylspiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione (PubChem CID 53376018) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is (3aR,6S,6aS,9aS,9bR)-3'-[4-(dimethylamino)phenyl]-6a-hydroxy-6,9a-dimethylspiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione.
| Compound Name | (3aR,6S,6aS,9aS,9bR)-3'-[4-(dimethylamino)phenyl]-6a-hydroxy-6,9a-dimethylspiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione |
|---|---|
| PubChem CID | 53376018 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (3aR,6S,6aS,9aS,9bR)-3'-[4-(dimethylamino)phenyl]-6a-hydroxy-6,9a-dimethylspiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione |
| SMILES | C[C@H]1CC[C@@H]2[C@@H](OC(=O)C23CC(c2ccc(N(C)C)cc2)=NO3)[C@]2(C)C(=O)C=C[C@@]12O |
| InChI | InChI=1S/C24H28N2O5/c1-14-5-10-17-20(22(2)19(27)11-12-24(14,22)29)30-21(28)23(17)13-18(25-31-23)15-6-8-16(9-7-15)26(3)4/h6-9,11-12,14,17,20,29H,5,10,13H2,1-4H3/t14-,17+,20+,22-,23?,24+/m0/s1 |
| InChIKey | ZSWJDJKNQKVLFN-OCLHRRKUSA-N |
| XLogP | 2.46 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |