C20H15FN2O3 — CID 53376050
8-(4-fluoroanilino)-6-methyl-3,4-dihydro-2H-phenanthridine-1,7,10-trione (PubChem CID 53376050) has the molecular formula C20H15FN2O3 and a molecular weight of 350.35 g/mol. Its IUPAC name is 8-(4-fluoroanilino)-6-methyl-3,4-dihydro-2H-phenanthridine-1,7,10-trione.
| Compound Name | 8-(4-fluoroanilino)-6-methyl-3,4-dihydro-2H-phenanthridine-1,7,10-trione |
|---|---|
| PubChem CID | 53376050 |
| Molecular Formula | C20H15FN2O3 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 8-(4-fluoroanilino)-6-methyl-3,4-dihydro-2H-phenanthridine-1,7,10-trione |
| SMILES | Cc1nc2c(c3c1C(=O)C(Nc1ccc(F)cc1)=CC3=O)C(=O)CCC2 |
| InChI | InChI=1S/C20H15FN2O3/c1-10-17-19(18-13(22-10)3-2-4-15(18)24)16(25)9-14(20(17)26)23-12-7-5-11(21)6-8-12/h5-9,23H,2-4H2,1H3 |
| InChIKey | CNIZQTGSWQJIAF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|