C23H16N2O4 — CID 53376052
8-anilino-6-(furan-2-yl)-3,4-dihydro-2H-phenanthridine-1,7,10-trione (PubChem CID 53376052) has the molecular formula C23H16N2O4 and a molecular weight of 384.39 g/mol. Its IUPAC name is 8-anilino-6-(furan-2-yl)-3,4-dihydro-2H-phenanthridine-1,7,10-trione.
| Compound Name | 8-anilino-6-(furan-2-yl)-3,4-dihydro-2H-phenanthridine-1,7,10-trione |
|---|---|
| PubChem CID | 53376052 |
| Molecular Formula | C23H16N2O4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 8-anilino-6-(furan-2-yl)-3,4-dihydro-2H-phenanthridine-1,7,10-trione |
| SMILES | O=C1CCCc2nc(-c3ccco3)c3c(c21)C(=O)C=C(Nc1ccccc1)C3=O |
| InChI | InChI=1S/C23H16N2O4/c26-16-9-4-8-14-19(16)20-17(27)12-15(24-13-6-2-1-3-7-13)23(28)21(20)22(25-14)18-10-5-11-29-18/h1-3,5-7,10-12,24H,4,8-9H2 |
| InChIKey | BPIRRXOHLCPNQV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|