C19H27N2O4S2+ — CID 53376060
(5Z)-3-[2-(dimethylamino)ethyl]-2-ethylsulfanyl-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazol-3-ium-4-one (PubChem CID 53376060) has the molecular formula C19H27N2O4S2+ and a molecular weight of 411.57 g/mol. Its IUPAC name is (5Z)-3-[2-(dimethylamino)ethyl]-2-ethylsulfanyl-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazol-3-ium-4-one.
| Compound Name | (5Z)-3-[2-(dimethylamino)ethyl]-2-ethylsulfanyl-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazol-3-ium-4-one |
|---|---|
| PubChem CID | 53376060 |
| Molecular Formula | C19H27N2O4S2+ |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | (5Z)-3-[2-(dimethylamino)ethyl]-2-ethylsulfanyl-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazol-3-ium-4-one |
| SMILES | CCSC1=[N+](CCN(C)C)C(=O)/C(=C/c2cc(OC)c(OC)c(OC)c2)S1 |
| InChI | InChI=1S/C19H27N2O4S2/c1-7-26-19-21(9-8-20(2)3)18(22)16(27-19)12-13-10-14(23-4)17(25-6)15(11-13)24-5/h10-12H,7-9H2,1-6H3/q+1/b16-12- |
| InChIKey | QFUHRJSDFYCMRF-VBKFSLOCSA-N |
| XLogP | 3.01 |
| TPSA | 51.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|