C19H13NO3 — CID 53376161
6-phenyl-3,4-dihydro-2H-phenanthridine-1,7,10-trione (PubChem CID 53376161) has the molecular formula C19H13NO3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 6-phenyl-3,4-dihydro-2H-phenanthridine-1,7,10-trione.
| Compound Name | 6-phenyl-3,4-dihydro-2H-phenanthridine-1,7,10-trione |
|---|---|
| PubChem CID | 53376161 |
| Molecular Formula | C19H13NO3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 6-phenyl-3,4-dihydro-2H-phenanthridine-1,7,10-trione |
| SMILES | O=C1CCCc2nc(-c3ccccc3)c3c(c21)C(=O)C=CC3=O |
| InChI | InChI=1S/C19H13NO3/c21-13-8-4-7-12-16(13)17-14(22)9-10-15(23)18(17)19(20-12)11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2 |
| InChIKey | YZKZSIKVHTVQSQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|