About 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione
6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione (PubChem CID 53376163) has the molecular formula C17H11NO3S
and a molecular weight of 309.35 g/mol. Its IUPAC name is 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione.
Molecular Properties
| Compound Name | 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione |
| PubChem CID | 53376163 |
| Molecular Formula | C17H11NO3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione |
| SMILES | O=C1CCCc2nc(-c3ccsc3)c3c(c21)C(=O)C=CC3=O |
| InChI | InChI=1S/C17H11NO3S/c19-11-3-1-2-10-14(11)15-12(20)4-5-13(21)16(15)17(18-10)9-6-7-22-8-9/h4-8H,1-3H2 |
| InChIKey | SPIBGKZWDJYVRJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione?
The IUPAC name of 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione (CID 53376163) is 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione.
What is the SMILES notation for 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione?
The canonical SMILES for 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione is O=C1CCCc2nc(-c3ccsc3)c3c(c21)C(=O)C=CC3=O.
What is the InChIKey of 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione?
The InChIKey is SPIBGKZWDJYVRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO3S/c19-11-3-1-2-10-14(11)15-12(20)4-5-13(21)16(15)17(18-10)9-6-7-22-8-9/h4-8H,1-3H2.
What are the key properties of 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione?
6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione has a molecular weight of 309.35 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-thiophen-3-yl-3,4-dihydro-2H-phenanthridine-1,7,10-trione is sourced from PubChem (CID 53376163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).