C23H25NO5 — CID 53376243
(3aR,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-3'-(4-methylphenyl)spiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione (PubChem CID 53376243) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is (3aR,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-3'-(4-methylphenyl)spiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione.
| Compound Name | (3aR,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-3'-(4-methylphenyl)spiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione |
|---|---|
| PubChem CID | 53376243 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (3aR,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-3'-(4-methylphenyl)spiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,5'-4H-1,2-oxazole]-2,9-dione |
| SMILES | Cc1ccc(C2=NOC3(C2)C(=O)O[C@@H]2[C@H]3CC[C@H](C)[C@]3(O)C=CC(=O)[C@@]23C)cc1 |
| InChI | InChI=1S/C23H25NO5/c1-13-4-7-15(8-5-13)17-12-22(29-24-17)16-9-6-14(2)23(27)11-10-18(25)21(23,3)19(16)28-20(22)26/h4-5,7-8,10-11,14,16,19,27H,6,9,12H2,1-3H3/t14-,16+,19+,21-,22?,23+/m0/s1 |
| InChIKey | DNKQMGOGLPLQOF-KOAQZSKVSA-N |
| XLogP | 2.71 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |