C28H20FNO5S — CID 53376804
methyl 4-[[(5Z)-5-[[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate (PubChem CID 53376804) has the molecular formula C28H20FNO5S and a molecular weight of 501.54 g/mol. Its IUPAC name is methyl 4-[[(5Z)-5-[[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(5Z)-5-[[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 53376804 |
| Molecular Formula | C28H20FNO5S |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | methyl 4-[[(5Z)-5-[[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C\c3ccc(/C=C/C(=O)c4ccc(F)cc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H20FNO5S/c1-35-27(33)22-9-6-20(7-10-22)17-30-26(32)25(36-28(30)34)16-19-4-2-18(3-5-19)8-15-24(31)21-11-13-23(29)14-12-21/h2-16H,17H2,1H3/b15-8+,25-16- |
| InChIKey | JOIPESRZGBOKAP-YOVYXIJGSA-N |
| XLogP | 5.74 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|