C28H21NO5S — CID 53377151
4-[[(5Z)-5-[[4-[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid (PubChem CID 53377151) has the molecular formula C28H21NO5S and a molecular weight of 483.55 g/mol. Its IUPAC name is 4-[[(5Z)-5-[[4-[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[(5Z)-5-[[4-[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 53377151 |
| Molecular Formula | C28H21NO5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 4-[[(5Z)-5-[[4-[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid |
| SMILES | Cc1ccc(C(=O)/C=C/c2ccc(/C=C3\SC(=O)N(Cc4ccc(C(=O)O)cc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C28H21NO5S/c1-18-2-11-22(12-3-18)24(30)15-10-19-4-6-20(7-5-19)16-25-26(31)29(28(34)35-25)17-21-8-13-23(14-9-21)27(32)33/h2-16H,17H2,1H3,(H,32,33)/b15-10+,25-16- |
| InChIKey | RHFFXBAXZTZLIY-FUPWBYONSA-N |
| XLogP | 5.83 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|