C29H23NO5S — CID 53377152
4-[[(5Z)-5-[[4-[(E)-3-(2,4-dimethylphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid (PubChem CID 53377152) has the molecular formula C29H23NO5S and a molecular weight of 497.57 g/mol. Its IUPAC name is 4-[[(5Z)-5-[[4-[(E)-3-(2,4-dimethylphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[(5Z)-5-[[4-[(E)-3-(2,4-dimethylphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 53377152 |
| Molecular Formula | C29H23NO5S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 4-[[(5Z)-5-[[4-[(E)-3-(2,4-dimethylphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid |
| SMILES | Cc1ccc(C(=O)/C=C/c2ccc(/C=C3\SC(=O)N(Cc4ccc(C(=O)O)cc4)C3=O)cc2)c(C)c1 |
| InChI | InChI=1S/C29H23NO5S/c1-18-3-13-24(19(2)15-18)25(31)14-10-20-4-6-21(7-5-20)16-26-27(32)30(29(35)36-26)17-22-8-11-23(12-9-22)28(33)34/h3-16H,17H2,1-2H3,(H,33,34)/b14-10+,26-16- |
| InChIKey | RJTRHCOBPNAHMK-KSFSMOJCSA-N |
| XLogP | 6.13 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|