C21H29NO5 — CID 53377281
(E)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N,N-diethylprop-2-enamide (PubChem CID 53377281) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is (E)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N,N-diethylprop-2-enamide.
| Compound Name | (E)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 53377281 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (E)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C/[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H29NO5/c1-5-22(6-2)17(23)13-12-16-18(24-14-15-10-8-7-9-11-15)19-20(25-16)27-21(3,4)26-19/h7-13,16,18-20H,5-6,14H2,1-4H3/b13-12+/t16-,18+,19-,20-/m1/s1 |
| InChIKey | KEZBFSFWIADOEN-NZGVNECCSA-N |
| XLogP | 2.87 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|