C27H19NO6S — CID 53377338
4-[[(5Z)-5-[[4-[(E)-3-(4-hydroxyphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid (PubChem CID 53377338) has the molecular formula C27H19NO6S and a molecular weight of 485.52 g/mol. Its IUPAC name is 4-[[(5Z)-5-[[4-[(E)-3-(4-hydroxyphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[(5Z)-5-[[4-[(E)-3-(4-hydroxyphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 53377338 |
| Molecular Formula | C27H19NO6S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 4-[[(5Z)-5-[[4-[(E)-3-(4-hydroxyphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2C(=O)S/C(=C\c3ccc(/C=C/C(=O)c4ccc(O)cc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H19NO6S/c29-22-12-10-20(11-13-22)23(30)14-7-17-1-3-18(4-2-17)15-24-25(31)28(27(34)35-24)16-19-5-8-21(9-6-19)26(32)33/h1-15,29H,16H2,(H,32,33)/b14-7+,24-15- |
| InChIKey | WOMZSCCOXIGCLY-DTAINRSBSA-N |
| XLogP | 5.22 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|