About (4-oxooxan-3-yl) 2-methylprop-2-enoate
(4-oxooxan-3-yl) 2-methylprop-2-enoate (PubChem CID 53377883) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is (4-oxooxan-3-yl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | (4-oxooxan-3-yl) 2-methylprop-2-enoate |
| PubChem CID | 53377883 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (4-oxooxan-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1COCCC1=O |
| InChI | InChI=1S/C9H12O4/c1-6(2)9(11)13-8-5-12-4-3-7(8)10/h8H,1,3-5H2,2H3 |
| InChIKey | OSPPHLQLVLQOJU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4-oxooxan-3-yl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxooxan-3-yl) 2-methylprop-2-enoate?
The IUPAC name of (4-oxooxan-3-yl) 2-methylprop-2-enoate (CID 53377883) is (4-oxooxan-3-yl) 2-methylprop-2-enoate.
What is the SMILES notation for (4-oxooxan-3-yl) 2-methylprop-2-enoate?
The canonical SMILES for (4-oxooxan-3-yl) 2-methylprop-2-enoate is C=C(C)C(=O)OC1COCCC1=O.
What is the InChIKey of (4-oxooxan-3-yl) 2-methylprop-2-enoate?
The InChIKey is OSPPHLQLVLQOJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-6(2)9(11)13-8-5-12-4-3-7(8)10/h8H,1,3-5H2,2H3.
What are the key properties of (4-oxooxan-3-yl) 2-methylprop-2-enoate?
(4-oxooxan-3-yl) 2-methylprop-2-enoate has a molecular weight of 184.19 g/mol, XLogP of 0.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxooxan-3-yl) 2-methylprop-2-enoate is sourced from PubChem (CID 53377883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).