About 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole
4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole (PubChem CID 53377900) has the molecular formula C21H21Cl2F2N3O
and a molecular weight of 440.32 g/mol. Its IUPAC name is 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole.
Molecular Properties
| Compound Name | 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole |
| PubChem CID | 53377900 |
| Molecular Formula | C21H21Cl2F2N3O |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole |
| SMILES | CCCCc1cn(CC(OCc2ccc(F)cc2F)c2ccc(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C21H21Cl2F2N3O/c1-2-3-4-17-11-28(27-26-17)12-21(18-8-6-15(22)9-19(18)23)29-13-14-5-7-16(24)10-20(14)25/h5-11,21H,2-4,12-13H2,1H3 |
| InChIKey | IQDNQWGCNVCRRZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole?
The IUPAC name of 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole (CID 53377900) is 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole.
What is the SMILES notation for 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole?
The canonical SMILES for 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole is CCCCc1cn(CC(OCc2ccc(F)cc2F)c2ccc(Cl)cc2Cl)nn1.
What is the InChIKey of 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole?
The InChIKey is IQDNQWGCNVCRRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21Cl2F2N3O/c1-2-3-4-17-11-28(27-26-17)12-21(18-8-6-15(22)9-19(18)23)29-13-14-5-7-16(24)10-20(14)25/h5-11,21H,2-4,12-13H2,1H3.
What are the key properties of 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole?
4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole has a molecular weight of 440.32 g/mol, XLogP of 6.16, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1-[2-(2,4-dichlorophenyl)-2-[(2,4-difluorophenyl)methoxy]ethyl]triazole is sourced from PubChem (CID 53377900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).