C24H33NO15 — CID 53378047
methyl (2R,4S,5R,6R)-2,4-diacetyloxy-5-(diacetylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 53378047) has the molecular formula C24H33NO15 and a molecular weight of 575.52 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-2,4-diacetyloxy-5-(diacetylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-2,4-diacetyloxy-5-(diacetylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 53378047 |
| Molecular Formula | C24H33NO15 |
| Molecular Weight | 575.52 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | methyl (2R,4S,5R,6R)-2,4-diacetyloxy-5-(diacetylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(OC(C)=O)C[C@H](OC(C)=O)[C@@H](N(C(C)=O)C(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C24H33NO15/c1-11(26)25(12(2)27)20-18(36-14(4)29)9-24(23(33)34-8,39-17(7)32)40-22(20)21(38-16(6)31)19(37-15(5)30)10-35-13(3)28/h18-22H,9-10H2,1-8H3/t18-,19+,20+,21+,22+,24-/m0/s1 |
| InChIKey | KPEVSRVXXLQIIU-LPDXNUGJSA-N |
| XLogP | -0.67 |
| TPSA | 204.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.52 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|