C18H26N2O — CID 5337820
(2E,6E)-2-[(2E,4E)-5-(dimethylamino)penta-2,4-dienylidene]-6-[(E)-3-(dimethylamino)prop-2-enylidene]cyclohexan-1-one (PubChem CID 5337820) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (2E,6E)-2-[(2E,4E)-5-(dimethylamino)penta-2,4-dienylidene]-6-[(E)-3-(dimethylamino)prop-2-enylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2-[(2E,4E)-5-(dimethylamino)penta-2,4-dienylidene]-6-[(E)-3-(dimethylamino)prop-2-enylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 5337820 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (2E,6E)-2-[(2E,4E)-5-(dimethylamino)penta-2,4-dienylidene]-6-[(E)-3-(dimethylamino)prop-2-enylidene]cyclohexan-1-one |
| SMILES | CN(C)/C=C/C=C/C=C1\CCC/C(=C\C=C\N(C)C)C1=O |
| InChI | InChI=1S/C18H26N2O/c1-19(2)14-7-5-6-10-16-11-8-12-17(18(16)21)13-9-15-20(3)4/h5-7,9-10,13-15H,8,11-12H2,1-4H3/b6-5+,14-7+,15-9+,16-10+,17-13+ |
| InChIKey | NRJNKEWIQGWMPD-SUMPGDTDSA-N |
| XLogP | 3.30 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|