C42H51N3O3 — CID 53378337
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 53378337) has the molecular formula C42H51N3O3 and a molecular weight of 645.89 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 53378337 |
| Molecular Formula | C42H51N3O3 |
| Molecular Weight | 645.89 g/mol |
| Exact Mass | 645.39 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCNC(=O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C42H51N3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26-31-38(46)43-34-35-44-39(47)32-33-40-45-41(36-27-22-20-23-28-36)42(48-40)37-29-24-21-25-30-37/h3-4,6-7,9-10,12-13,15-16,18-25,27-30H,2,5,8,11,14,17,26,31-35H2,1H3,(H,43,46)(H,44,47)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | SOEDQLGRNPOMMA-KUBAVDMBSA-N |
| XLogP | 9.65 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.89 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|