C26H36N10O3 — CID 53378658
1-[4-(aminomethyl)-2-(3-aminopropoxy)phenyl]-3-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]urea (PubChem CID 53378658) has the molecular formula C26H36N10O3 and a molecular weight of 536.64 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-2-(3-aminopropoxy)phenyl]-3-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]urea.
| Compound Name | 1-[4-(aminomethyl)-2-(3-aminopropoxy)phenyl]-3-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 53378658 |
| Molecular Formula | C26H36N10O3 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | 1-[4-(aminomethyl)-2-(3-aminopropoxy)phenyl]-3-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]urea |
| SMILES | NCCCOc1cc(CN)ccc1NC(=O)Nc1ncc(-c2ccc(CNCCCN=C(N)N)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C26H36N10O3/c27-9-1-12-39-22-13-18(14-28)5-8-21(22)34-26(38)36-25-33-16-20(23(37)35-25)19-6-3-17(4-7-19)15-31-10-2-11-32-24(29)30/h3-8,13,16,31H,1-2,9-12,14-15,27-28H2,(H4,29,30,32)(H3,33,34,35,36,37,38) |
| InChIKey | XAKJULCCDYMPEF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 224.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|